(5S)-2ξ,3ξ,10-trimethyl-2,3,6,7,8,9-hexahydro-5H-5r,8c-epiazano-cyclohepta[b]pyran-4-one structure
|
Common Name | (5S)-2ξ,3ξ,10-trimethyl-2,3,6,7,8,9-hexahydro-5H-5r,8c-epiazano-cyclohepta[b]pyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 72362-48-2 | Molecular Weight | 221.29500 | |
| Density | 1.15g/cm3 | Boiling Point | 327.9ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | (5S)-2ξ,3ξ,10-trimethyl-2,3,6,7,8,9-hexahydro-5H-5r,8c-epiazano-cyclohepta[b]pyran-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760 mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 152.1ºC |
| Exact Mass | 221.14200 |
| PSA | 29.54000 |
| LogP | 1.66880 |
| Index of Refraction | 1.549 |
| InChIKey | NFKOVCVVWNXFIF-UHFFFAOYSA-N |
| SMILES | CC1OC2=C(C(=O)C1C)C1CCC(C2)N1C |
|
~%
(5S)-2ξ,3ξ,10-t... CAS#:72362-48-2 |
| Literature: Majewski; Lazny Journal of Organic Chemistry, 1995 , vol. 60, # 18 p. 5825 - 5830 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Cyclohepta(b)pyran-5,8-imin-4(5H)-one,2,3,6,7,8,9-hexahydro-2,3,10-trimethyl |
| 2,3,10-trimethyl-2,3,6,7,8,9-hexahydro-5,8-epiminocyclohepta[b]pyran-4(5H)-one |
| 2,3-Dihydrodarlingin |