3-pentyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 3-pentyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 7061-37-2 | Molecular Weight | 434.57700 | |
| Density | 1.28g/cm3 | Boiling Point | 609.1ºC at 760 mmHg | |
| Molecular Formula | C23H22N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.2ºC | |
| Name | 3-pentyl-5-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 609.1ºC at 760 mmHg |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.57700 |
| Flash Point | 322.2ºC |
| Exact Mass | 434.12400 |
| PSA | 108.41000 |
| LogP | 5.26360 |
| Index of Refraction | 1.68 |
| InChIKey | ITHUXMUDUDORRK-UHFFFAOYSA-N |
| SMILES | CCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2ccncc2)SC1=S |
|
~%
3-pentyl-5-[(1-... CAS#:7061-37-2 |
| Literature: Nozoe,T. et al. Bulletin of the Chemical Society of Japan, 1966 , vol. 39, # 6 p. 1310 - 1316 |
|
~%
3-pentyl-5-[(1-... CAS#:7061-37-2 |
| Literature: Nozoe,T. et al. Bulletin of the Chemical Society of Japan, 1966 , vol. 39, # 6 p. 1310 - 1316 |