3,5,7-trioxodecanoic acid
Modify Date: 2025-08-26 11:08:53
3,5,7-trioxodecanoic acid structure
|
Common Name | 3,5,7-trioxodecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7028-39-9 | Molecular Weight | 214.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,7-trioxodecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14O5 |
|---|---|
| Molecular Weight | 214.21500 |
| Exact Mass | 214.08400 |
| PSA | 88.51000 |
| LogP | 0.74870 |
| InChIKey | YHIPJWOFEPJIGL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)CC(=O)CC(=O)CC(=O)O |
|
~%
3,5,7-trioxodec... CAS#:7028-39-9 |
| Literature: Harris,T.M. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 7733 - 7741 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Decanoic acid,3,5,7-trioxo |
| 3,5,7-Trioxo-decansaeure |