7-(2-chloroprop-2-enoxy)-4,8-dimethylchromen-2-one structure
|
Common Name | 7-(2-chloroprop-2-enoxy)-4,8-dimethylchromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 69897-63-8 | Molecular Weight | 264.70400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(2-chloroprop-2-enoxy)-4,8-dimethylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13ClO3 |
|---|---|
| Molecular Weight | 264.70400 |
| Exact Mass | 264.05500 |
| PSA | 39.44000 |
| LogP | 3.54110 |
| InChIKey | DOHZWGZYKUIICQ-UHFFFAOYSA-N |
| SMILES | C=C(Cl)COc1ccc2c(C)cc(=O)oc2c1C |
|
~75%
7-(2-chloroprop... CAS#:69897-63-8 |
| Literature: Thomas C. Elder, Inc. Patent: US4216154 A1, 1980 ; |
|
~%
7-(2-chloroprop... CAS#:69897-63-8 |
| Literature: The Regents of the University of California Patent: US4398031 A1, 1983 ; |
| 4,8-dimethyl-7-(2'-chloroallyloxy)coumarin |
| 7-(2-chloro-allyloxy)-4,8-dimethyl-chromen-2-one |
| 2H-1-Benzopyran-2-one,7-[(2-chloro-2-propenyl)oxy]-4,8-dimethyl |