5-acetamido-3-amino-2-hydroxybenzenesulfonic acid
Modify Date: 2025-09-22 20:05:52
5-acetamido-3-amino-2-hydroxybenzenesulfonic acid structure
|
Common Name | 5-acetamido-3-amino-2-hydroxybenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6856-14-0 | Molecular Weight | 246.24000 | |
| Density | 1.686g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-acetamido-3-amino-2-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.686g/cm3 |
|---|---|
| Molecular Formula | C8H10N2O5S |
| Molecular Weight | 246.24000 |
| Exact Mass | 246.03100 |
| PSA | 138.10000 |
| LogP | 1.91450 |
| Index of Refraction | 1.681 |
| InChIKey | FVELBSCPKVNJHA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(N)c(O)c(S(=O)(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~%
5-acetamido-3-a... CAS#:6856-14-0 |
| Literature: Cassella and Co. Patent: DE163185 ; Full Text Show Details Cassella and Co. Patent: DE149106 ; |
|
~%
5-acetamido-3-a... CAS#:6856-14-0 |
| Literature: Hoechster Farbw. Patent: DE164295 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenesulfonic acid,5-(acetylamino)-3-amino-2-hydroxy |
| 5-Acetamido-3-amino-2-hydroxybenzenesulphonic acid |
| 5-acetylamino-3-amino-2-hydroxy-benzenesulfonic acid |
| 6-Amino-4-acetamino-phenol-sulfonsaeure-(2) |
| EINECS 229-952-7 |
| 5-Acetylamino-3-amino-2-hydroxy-benzolsulfonsaeure |