ethenyl acetate,methyl sulfate,trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium
Modify Date: 2025-09-19 19:15:33
![ethenyl acetate,methyl sulfate,trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium Structure](https://image.chemsrc.com/caspic/410/67785-55-1.png)
ethenyl acetate,methyl sulfate,trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium structure
|
Common Name | ethenyl acetate,methyl sulfate,trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium | ||
|---|---|---|---|---|
| CAS Number | 67785-55-1 | Molecular Weight | 369.43100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H27NO8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl acetate,methyl sulfate,trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H27NO8S |
|---|---|
| Molecular Weight | 369.43100 |
| Exact Mass | 369.14600 |
| PSA | 127.41000 |
| LogP | 1.67870 |
| InChIKey | CPAMJNAAXPYOKZ-UHFFFAOYSA-M |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C.C=COC(C)=O.COS(=O)(=O)[O-] |
| Ethenyl acetate,polymer with N,N,N-trimethyl-2-((2-methyl-1-oxo-2-propenyl)oxy)ethanaminium methyl sulfate |
| Ethanaminium,N,N,N-trimethyl-2-((2-methyl-1-oxo-2-propenyl)oxy)-,methyl sulfate,polymer with ethenyl acetate |
| Ethanaminium,N,N,N-trimethyl-2-((2-methyl-1-oxo-2-propen-1-yl)oxy)-,methyl sulfate (1:1),polymer with ethenyl acetate |