5-amino-2-(3,5-dimethylphenyl)isoindole-1,3-dione structure
|
Common Name | 5-amino-2-(3,5-dimethylphenyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 651733-76-5 | Molecular Weight | 266.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-2-(3,5-dimethylphenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2O2 |
|---|---|
| Molecular Weight | 266.29500 |
| Exact Mass | 266.10600 |
| PSA | 63.40000 |
| LogP | 3.33240 |
| InChIKey | QPQCLRUQTFTLDL-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(N2C(=O)c3ccc(N)cc3C2=O)c1 |
|
~%
5-amino-2-(3,5-... CAS#:651733-76-5 |
| Literature: Suizu, Mamiko; Muroya, Yohei; Kakuta, Hiroki; Kagechika, Hiroyuki; Tanatani, Aya; Nagasawa, Kazuo; Hashimoto, Yuichi Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 9 p. 1098 - 1102 |
|
~%
5-amino-2-(3,5-... CAS#:651733-76-5 |
| Literature: Suizu, Mamiko; Muroya, Yohei; Kakuta, Hiroki; Kagechika, Hiroyuki; Tanatani, Aya; Nagasawa, Kazuo; Hashimoto, Yuichi Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 9 p. 1098 - 1102 |
|
~%
5-amino-2-(3,5-... CAS#:651733-76-5 |
| Literature: Suizu, Mamiko; Muroya, Yohei; Kakuta, Hiroki; Kagechika, Hiroyuki; Tanatani, Aya; Nagasawa, Kazuo; Hashimoto, Yuichi Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 9 p. 1098 - 1102 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Isoindole-1,3(2H)-dione,5-amino-2-(3,5-dimethylphenyl) |