methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid
Modify Date: 2026-09-20 00:57:14
methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid structure
|
Common Name | methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid | ||
|---|---|---|---|---|
| CAS Number | 64141-48-6 | Molecular Weight | 295.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15F2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15F2NO4S |
|---|---|
| Molecular Weight | 295.30 |
| InChIKey | WUHHOLWVZABPEI-UHFFFAOYSA-N |
| SMILES | COC(=NC(C)C)c1ccccc1F.O=S(=O)(O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: The English name of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid. |
| Q: What is the Chinese name of 64141-48-6? |
| A: Chinese name of 64141-48-6 is 64141-48-6. |
| Q: What is the CAS number of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: CAS number of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is 64141-48-6. |
| Q: What is the molecular weight of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: Molecular weight of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is 295.30. |
| Q: What is the molecular formula of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: Molecular formula of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is C11H15F2NO4S. |
| Q: What is the SMILES notation of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: SMILES notation of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is COC(=NC(C)C)c1ccccc1F.O=S(=O)(O)F. |
| Q: What is the InChIKey of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid? |
| A: InChIKey of methyl 2-fluoro-N-propan-2-ylbenzenecarboximidate;sulfurofluoridic acid is WUHHOLWVZABPEI-UHFFFAOYSA-N. |