3,4,6,7-tetramethoxyphenanthrene-1-carbaldehyde
Modify Date: 2025-09-28 21:17:54
3,4,6,7-tetramethoxyphenanthrene-1-carbaldehyde structure
|
Common Name | 3,4,6,7-tetramethoxyphenanthrene-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 63955-83-9 | Molecular Weight | 326.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4,6,7-tetramethoxyphenanthrene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H18O5 |
|---|---|
| Molecular Weight | 326.34300 |
| Exact Mass | 326.11500 |
| PSA | 53.99000 |
| LogP | 3.83990 |
| InChIKey | JEVIJYLEBNOVKC-UHFFFAOYSA-N |
| SMILES | COc1cc2ccc3c(C=O)cc(OC)c(OC)c3c2cc1OC |
|
~%
3,4,6,7-tetrame... CAS#:63955-83-9 |
| Literature: Bhakuni; Tewari; Kapil Journal of the Chemical Society. Perkin transactions 1, 1977 , # 6 p. 706 - 709 |
| 1-Phenanthrenecarboxaldehyde,3,4,6,7-tetramethoxy |