diethyl-[1-(9H-fluorene-9-carbonyloxy)propan-2-yl]azanium,chloride structure
|
Common Name | diethyl-[1-(9H-fluorene-9-carbonyloxy)propan-2-yl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63918-46-7 | Molecular Weight | 359.89000 | |
| Density | N/A | Boiling Point | 454.1ºC at 760mmHg | |
| Molecular Formula | C21H26ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.7ºC | |
| Name | diethyl-[1-(9H-fluorene-9-carbonyloxy)propan-2-yl]azanium,chloride |
|---|
| Boiling Point | 454.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.89000 |
| Flash Point | 146.7ºC |
| Exact Mass | 359.16500 |
| PSA | 29.54000 |
| LogP | 4.87440 |
| InChIKey | HDLBXIMVKQPNNL-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)C(C)COC(=O)C1c2ccccc2-c2ccccc21.[Cl-] |
|
~%
diethyl-[1-(9H-... CAS#:63918-46-7 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 262,263 |
|
~%
diethyl-[1-(9H-... CAS#:63918-46-7 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 262,263 |