(3,4-dichloro-5-oxo-2H-furan-2-yl) acetate structure
|
Common Name | (3,4-dichloro-5-oxo-2H-furan-2-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 63031-44-7 | Molecular Weight | 211.00000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dichloro-5-oxo-2H-furan-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl2O4 |
|---|---|
| Molecular Weight | 211.00000 |
| Exact Mass | 209.94900 |
| PSA | 52.60000 |
| LogP | 1.12160 |
| InChIKey | HQHJOUFXKZWWIG-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1OC(=O)C(Cl)=C1Cl |
|
~95%
(3,4-dichloro-5... CAS#:63031-44-7 |
| Literature: Blazecka, Peter Garth; Zhang, Ji Patent: US2005/59831 A1, 2005 ; Location in patent: Page/Page column 7 ; |
|
~94%
(3,4-dichloro-5... CAS#:63031-44-7 |
| Literature: Blazecka, Peter G.; Belmont, Daniel; Curran, Tim; Pflum, Derek; Zhang, Ji Organic Letters, 2003 , vol. 5, # 26 p. 5015 - 5017 |
|
~%
(3,4-dichloro-5... CAS#:63031-44-7 |
| Literature: Mowry Journal of the American Chemical Society, 1950 , vol. 72, p. 2535 |
| 5-acetoxy-3,4-dichloro-5H-furan-2-one |
| 5-acetoxy-3,4-dichloro-2(5H)-furanone |
| 4-acetoxy-2,3-dichloro-2-buten-4-olide |
| 5-Acetoxy-3,4-dichlor-5H-furan-2-on |
| mucochloric acid acetate |
| 2(5H)-Furanone,5-(acetyloxy)-3,4-dichloro |