3-hydroxy-3,4-diphenylcyclohexan-1-one
Modify Date: 2025-08-20 12:08:11
3-hydroxy-3,4-diphenylcyclohexan-1-one structure
|
Common Name | 3-hydroxy-3,4-diphenylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6303-86-2 | Molecular Weight | 266.33400 | |
| Density | 1.174g/cm3 | Boiling Point | 433ºC at 760mmHg | |
| Molecular Formula | C18H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 3-hydroxy-3,4-diphenylcyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 433ºC at 760mmHg |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.33400 |
| Flash Point | 184.7ºC |
| Exact Mass | 266.13100 |
| PSA | 37.30000 |
| LogP | 3.41100 |
| Index of Refraction | 1.605 |
| InChIKey | YAGJMWXQGIIUGP-UHFFFAOYSA-N |
| SMILES | O=C1CCC(c2ccccc2)C(O)(c2ccccc2)C1 |
|
~%
3-hydroxy-3,4-d... CAS#:6303-86-2 |
| Literature: Ross,N.C.; Levine,R. Journal of Organic Chemistry, 1964 , vol. 29, p. 2341 - 2346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Hydroxy-3,4-diphenyl-cyclohexanon |