[2-(benzenesulfonyl)-2-benzylbut-3-enyl]benzene structure
|
Common Name | [2-(benzenesulfonyl)-2-benzylbut-3-enyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 62872-75-7 | Molecular Weight | 362.48500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(benzenesulfonyl)-2-benzylbut-3-enyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22O2S |
|---|---|
| Molecular Weight | 362.48500 |
| Exact Mass | 362.13400 |
| PSA | 42.52000 |
| LogP | 5.95130 |
| InChIKey | MPKPLBXSGWJBCL-UHFFFAOYSA-N |
| SMILES | C=CC(Cc1ccccc1)(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
|
~%
[2-(benzenesulf... CAS#:62872-75-7 |
| Literature: Savoia,D. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 123 - 125 |
| 3,3-Dibenzyl-3-phenylsulfonyl-prop-1-en |
| Benzene,1,1'-[2-ethenyl-2-(phenylsulfonyl)-1,3-propanediyl]bis |