2-benzhydrylidene-4-methoxynaphthalen-1-one structure
|
Common Name | 2-benzhydrylidene-4-methoxynaphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 62315-45-1 | Molecular Weight | 338.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzhydrylidene-4-methoxynaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H18O2 |
|---|---|
| Molecular Weight | 338.39900 |
| Exact Mass | 338.13100 |
| PSA | 26.30000 |
| LogP | 5.37230 |
| InChIKey | NRFJVGOBJHXTNS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(c2ccccc2)c2ccccc2)C(=O)c2ccccc21 |
|
~%
2-benzhydrylide... CAS#:62315-45-1 |
| Literature: Ettlinger Journal of the American Chemical Society, 1954 , vol. 76, p. 2769,2775 |
|
~%
2-benzhydrylide... CAS#:62315-45-1 |
| Literature: Ettlinger Journal of the American Chemical Society, 1954 , vol. 76, p. 2769,2775 |
| 4-Methoxy-1,2-naphthochinon-2-diphenylmethid |
| 1(2H)-Naphthalenone,2-(diphenylmethylene)-4-methoxy |
| 2-Benzhydryliden-4-methoxy-2H-naphthalin-1-on |
| 2-benzhydrylidene-4-methoxy-2H-naphthalen-1-one |