ethyl 5-amino-4-nitrofuran-2-carboxylate
Modify Date: 2025-08-24 21:24:03
ethyl 5-amino-4-nitrofuran-2-carboxylate structure
|
Common Name | ethyl 5-amino-4-nitrofuran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6132-35-0 | Molecular Weight | 200.14900 | |
| Density | 1.498g/cm3 | Boiling Point | 386.9ºC at 760mmHg | |
| Molecular Formula | C7H8N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8ºC | |
| Name | ethyl 5-amino-4-nitrofuran-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.498g/cm3 |
|---|---|
| Boiling Point | 386.9ºC at 760mmHg |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.14900 |
| Flash Point | 187.8ºC |
| Exact Mass | 200.04300 |
| PSA | 111.28000 |
| LogP | 2.05110 |
| Index of Refraction | 1.646 |
| InChIKey | SQTLKEATCAMPIA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])c(N)o1 |
|
~80%
ethyl 5-amino-4... CAS#:6132-35-0 |
| Literature: Prousek, Josef; Jurasek, Adolf; Kovac, Jaroslav Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 1 p. 135 - 141 |
|
~%
ethyl 5-amino-4... CAS#:6132-35-0 |
| Literature: Prousek, Josef; Jurasek, Adolf; Kovac, Jaroslav Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 1 p. 135 - 141 |
| 2-Furoic acid,5-amino-4-nitro-,ethyl ester |
| Ethyl 5-amino-4-nitro-2-furoate |
| ethyl 4-nitro-5-aminofuroate |