1-(2-hydroxy-5-methylphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(2-hydroxy-5-methylphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 61313-39-1 | Molecular Weight | 268.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-5-methylphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O3 |
|---|---|
| Molecular Weight | 268.30700 |
| Exact Mass | 268.11000 |
| PSA | 46.53000 |
| LogP | 3.60530 |
| InChIKey | VDPFEWCCQGZHGE-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C=CC(=O)c1cc(C)ccc1O |
|
~%
1-(2-hydroxy-5-... CAS#:61313-39-1 |
| Literature: Ballantine; Whalley Journal of the Chemical Society, 1956 , p. 3224 |
| 2'-Hydroxy-2-methoxy-5'-methyl-trans-chalkon |
| 2'-hydroxy-2-methoxy-5'-methyl-trans-chalcone |
| 2'-HYDROXY-5'-METHYL-2-METHOXYCHALCONE |