N-phenyl-2-(2-phenylacetyl)benzamide structure
|
Common Name | N-phenyl-2-(2-phenylacetyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 60984-32-9 | Molecular Weight | 315.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-phenyl-2-(2-phenylacetyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H17NO2 |
|---|---|
| Molecular Weight | 315.36500 |
| Exact Mass | 315.12600 |
| PSA | 49.66000 |
| LogP | 4.74830 |
| InChIKey | ZLRLPDPKNRTHSM-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1ccccc1C(=O)Nc1ccccc1 |
|
~66%
N-phenyl-2-(2-p... CAS#:60984-32-9 |
| Literature: Scartoni; Tognetti Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 5 p. 1499 - 1503 |
|
~%
N-phenyl-2-(2-p... CAS#:60984-32-9 |
| Literature: Scartoni; Tognetti Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 5 p. 1499 - 1503 |
| o-Phenylcetylbenzoic Acid Anilide |
| N-Phenyl-o-benzylcarbonyl-benzamid |
| N-Phenyl-desoxybenzoin-o-carboxamid |
| Benzamide,N-phenyl-2-(phenylacetyl) |