1-(3-iodopropyl)-3,7-dimethylpurine-2,6-dione structure
|
Common Name | 1-(3-iodopropyl)-3,7-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 60971-83-7 | Molecular Weight | 348.14000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13IN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-iodopropyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13IN4O2 |
|---|---|
| Molecular Weight | 348.14000 |
| Exact Mass | 348.00800 |
| PSA | 61.82000 |
| LogP | 0.25880 |
| InChIKey | VKHUHHFSOKRRJQ-UHFFFAOYSA-N |
| SMILES | Cn1cnc2c1c(=O)n(CCCI)c(=O)n2C |
|
~74%
1-(3-iodopropyl... CAS#:60971-83-7 |
| Literature: Zlatkov; Peikov; Rodriguez-Alvarez; Danchev; Nikolova; Mitkov European Journal of Medicinal Chemistry, 2000 , vol. 35, # 10 p. 941 - 948 |
|
~%
1-(3-iodopropyl... CAS#:60971-83-7 |
| Literature: Zlatkov; Peikov; Rodriguez-Alvarez; Danchev; Nikolova; Mitkov European Journal of Medicinal Chemistry, 2000 , vol. 35, # 10 p. 941 - 948 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-<3-Iod-propyl>-3,7-dimethyl-xanthin |