2-[(2,6-dichlorophenyl)carbamoyl-(2-methylpropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide
Modify Date: 2025-09-21 15:50:03
![2-[(2,6-dichlorophenyl)carbamoyl-(2-methylpropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide Structure](https://image.chemsrc.com/caspic/444/6026-60-4.png)
2-[(2,6-dichlorophenyl)carbamoyl-(2-methylpropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide structure
|
Common Name | 2-[(2,6-dichlorophenyl)carbamoyl-(2-methylpropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 6026-60-4 | Molecular Weight | 536.48900 | |
| Density | 1.323g/cm3 | Boiling Point | 692.6ºC at 760mmHg | |
| Molecular Formula | C26H28Cl2FN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.6ºC | |
| Name | 2-[(2,6-dichlorophenyl)carbamoyl-(2-methylpropyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 692.6ºC at 760mmHg |
| Molecular Formula | C26H28Cl2FN3O2S |
| Molecular Weight | 536.48900 |
| Flash Point | 372.6ºC |
| Exact Mass | 535.12600 |
| PSA | 84.38000 |
| LogP | 7.23490 |
| Index of Refraction | 1.619 |
| InChIKey | ORFPMGWJDWEAAQ-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc([Si](OCC)(OCC)OCC)cc1 |
|
~%
2-[(2,6-dichlor... CAS#:6026-60-4 |
| Literature: KABUSHIKI KAISHA TOYOTA CHUO KENKYUSHO; TOYOSHI SHIMADA Patent: US2008/227939 A1, 2008 ; Location in patent: Page/Page column 22-23 ; |
|
~75%
2-[(2,6-dichlor... CAS#:6026-60-4 |
| Literature: Ronchi; Pizzotti; Orbelli Biroli; Macchi; Lucenti; Zucchi Journal of Organometallic Chemistry, 2007 , vol. 692, # 9 p. 1788 - 1798 |
| 4-(triethoxysilyl)styrene |
| Triethoxy-<4-vinyl-phenyl>-silan |
| 4-vinylPhSi(OEt)3 |