3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride structure
|
Common Name | 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 59952-40-8 | Molecular Weight | 316.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9Br2ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9Br2ClO |
|---|---|
| Molecular Weight | 316.41700 |
| Exact Mass | 313.87100 |
| PSA | 17.07000 |
| LogP | 3.65520 |
| InChIKey | JIIXEQFJRLRHSW-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C=C(Br)Br)C1C(=O)Cl |
|
~%
3-(2,2-dibromoe... CAS#:59952-40-8 |
| Literature: FMC Corporation Patent: US4333950 A1, 1982 ; |
|
~%
3-(2,2-dibromoe... CAS#:59952-40-8 |
| Literature: Lee, Nanju; McAdam, David P.; Skerritt, John H. Journal of Agricultural and Food Chemistry, 1998 , vol. 46, # 2 p. 520 - 534 |
|
~%
3-(2,2-dibromoe... CAS#:59952-40-8 |
| Literature: Lee, Nanju; McAdam, David P.; Skerritt, John H. Journal of Agricultural and Food Chemistry, 1998 , vol. 46, # 2 p. 520 - 534 |
| 2,2-dimethyl-3-(2,2-dibromoethenyl)-cyclopropane-1-carboxylic acid chloride |
| 2,2-dimethyl-3-(2',2'-dibromovinyl)-cyclopropanecarboxylic acid chloride |
| 3-(2',2'-dibromovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid chloride |
| 3-(2,2-dibromoethenyl)-2,2-dimethyl-cyclopropane-carboxylic acid chloride |
| Cyclopropanecarbonyl chloride,3-(2,2-dibromoethenyl)-2,2-dimethyl |
| 2,2-dimethyl-3-(2',2'-dibromovinyl)-cyclopropane-1-carboxylic acid chloride |
| 3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl chloride |
| (+)-cis-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl chloride |