1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine
Modify Date: 2025-08-28 09:26:00
1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine structure
|
Common Name | 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine | ||
|---|---|---|---|---|
| CAS Number | 5994-95-6 | Molecular Weight | 328.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28N2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine |
|---|
| Molecular Formula | C18H28N2Si2 |
|---|---|
| Molecular Weight | 328.59900 |
| Exact Mass | 328.17900 |
| PSA | 6.48000 |
| LogP | 5.58440 |
| InChIKey | KZVGBFZABXRJFE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(c1ccccc1)N(c1ccccc1)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4147-89-1| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |