3-(tritylamino)propanoic acid
Modify Date: 2025-09-21 17:20:39
3-(tritylamino)propanoic acid structure
|
Common Name | 3-(tritylamino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 58995-30-5 | Molecular Weight | 331.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(tritylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H21NO2 |
|---|---|
| Molecular Weight | 331.40800 |
| Exact Mass | 331.15700 |
| PSA | 49.33000 |
| LogP | 4.43370 |
| InChIKey | DRBJRRIAZMJBOC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-[(triphenylmethyl)amino]propanoic acid |
| 3-(TRITYL-AMINO)PROPANOIC ACID |
| 3-(tritylamino)propionic acid |