3-[bis(2-chloroethyl)amino]-4-bromobenzoic acid
Modify Date: 2025-10-01 22:02:27
![3-[bis(2-chloroethyl)amino]-4-bromobenzoic acid Structure](https://image.chemsrc.com/caspic/398/58278-34-5.png)
3-[bis(2-chloroethyl)amino]-4-bromobenzoic acid structure
|
Common Name | 3-[bis(2-chloroethyl)amino]-4-bromobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 58278-34-5 | Molecular Weight | 341.02800 | |
| Density | 1.609g/cm3 | Boiling Point | 462.7ºC at 760 mmHg | |
| Molecular Formula | C11H12BrCl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | 3-[bis(2-chloroethyl)amino]-4-bromobenzoic acid |
|---|
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 462.7ºC at 760 mmHg |
| Molecular Formula | C11H12BrCl2NO2 |
| Molecular Weight | 341.02800 |
| Flash Point | 233.6ºC |
| Exact Mass | 338.94300 |
| PSA | 40.54000 |
| LogP | 3.43130 |
| Index of Refraction | 1.616 |
| InChIKey | DDNIKTXDMMWOHF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Br)c(N(CCCl)CCCl)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |