2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid structure
|
Common Name | 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 57715-98-7 | Molecular Weight | 303.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H3F6NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H3F6NO4 |
|---|---|
| Molecular Weight | 303.11 |
| InChIKey | WTEPOFADKMSMMH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(C(F)(F)F)cc([N+](=O)[O-])cc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: CAS number of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is 57715-98-7. |
| Q: What is the SMILES notation of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: SMILES notation of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is O=C(O)c1c(C(F)(F)F)cc([N+](=O)[O-])cc1C(F)(F)F. |
| Q: What is the molecular formula of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: Molecular formula of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is C9H3F6NO4. |
| Q: What is the Chinese name of 57715-98-7? |
| A: Chinese name of 57715-98-7 is 57715-98-7. |
| Q: What is the English name of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: The English name of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid. |
| Q: What is the molecular weight of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: Molecular weight of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is 303.11. |
| Q: What is the InChIKey of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid? |
| A: InChIKey of 2,6-Bis(trifluoromethyl)-4-nitrobenzoic acid is WTEPOFADKMSMMH-UHFFFAOYSA-N. |