8-phenylsulfanylnaphthalene-1-carboxylic acid structure
|
Common Name | 8-phenylsulfanylnaphthalene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 57360-19-7 | Molecular Weight | 280.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-phenylsulfanylnaphthalene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H12O2S |
|---|---|
| Molecular Weight | 280.34100 |
| Exact Mass | 280.05600 |
| PSA | 62.60000 |
| LogP | 4.68920 |
| InChIKey | DITBATKOGDRKFQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2cccc(Sc3ccccc3)c12 |
|
~%
8-phenylsulfany... CAS#:57360-19-7 |
| Literature: Rule; Turner Journal of the Chemical Society, 1935 , p. 317 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-phenylthio-1-naphthoic acid |