3,5-bis(4-bromophenyl)-4H-1,2,4-triazole
Modify Date: 2025-09-13 11:09:19
3,5-bis(4-bromophenyl)-4H-1,2,4-triazole structure
|
Common Name | 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole | ||
|---|---|---|---|---|
| CAS Number | 55368-79-1 | Molecular Weight | 379.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Br2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9Br2N3 |
|---|---|
| Molecular Weight | 379.05 |
| InChIKey | TVGRXGCNVLGQTC-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2n[nH]c(-c3ccc(Br)cc3)n2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: Molecular weight of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is 379.05. |
| Q: What is the CAS number of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: CAS number of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is 55368-79-1. |
| Q: What is the InChIKey of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: InChIKey of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is TVGRXGCNVLGQTC-UHFFFAOYSA-N. |
| Q: What is the English name of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: The English name of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole. |
| Q: What is the molecular formula of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: Molecular formula of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is C14H9Br2N3. |
| Q: What is the SMILES notation of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole? |
| A: SMILES notation of 3,5-bis(4-bromophenyl)-4H-1,2,4-triazole is Brc1ccc(-c2n[nH]c(-c3ccc(Br)cc3)n2)cc1. |
| Q: What is the Chinese name of 55368-79-1? |
| A: Chinese name of 55368-79-1 is 55368-79-1. |