methyl 1-methoxy-4-oxocyclohexa-2,5-diene-1-carboxylate structure
|
Common Name | methyl 1-methoxy-4-oxocyclohexa-2,5-diene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 55144-34-8 | Molecular Weight | 182.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1-methoxy-4-oxocyclohexa-2,5-diene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10O4 |
|---|---|
| Molecular Weight | 182.17300 |
| Exact Mass | 182.05800 |
| PSA | 52.60000 |
| LogP | 0.23970 |
| InChIKey | IVSHUHUNEQCMKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(OC)C=CC(=O)C=C1 |
|
~%
methyl 1-methox... CAS#:55144-34-8 |
| Literature: Weinberg,N.L. et al. Journal of the American Chemical Society, 1975 , vol. 97, p. 1499 - 1504 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Methoxy-4-carbomethoxy-2.5-cyclohexadienon |
| 2,5-Cyclohexadiene-1-carboxylic acid,1-methoxy-4-oxo-,methyl ester |