bis(2-methylbutyl)-phenylphosphane
Modify Date: 2025-11-28 12:03:00
bis(2-methylbutyl)-phenylphosphane structure
|
Common Name | bis(2-methylbutyl)-phenylphosphane | ||
|---|---|---|---|---|
| CAS Number | 54665-48-4 | Molecular Weight | 250.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2-methylbutyl)-phenylphosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H27P |
|---|---|
| Molecular Weight | 250.35900 |
| Exact Mass | 250.18500 |
| PSA | 13.59000 |
| LogP | 4.88600 |
| InChIKey | IAUNCXRXPFMJEO-UHFFFAOYSA-N |
| SMILES | CCC(C)CP(CC(C)CC)c1ccccc1 |
|
~%
bis(2-methylbut... CAS#:54665-48-4 |
| Literature: Davies; Pearse; Jones Journal of the Chemical Society, 1929 , p. 1264 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| bis-(2-methyl-butyl)-phenyl-phosphine |
| Phosphine,bis(2-methylbutyl)phenyl |