3,4-diphenylfuran-2-carboxylic acid
Modify Date: 2025-08-26 15:39:14
3,4-diphenylfuran-2-carboxylic acid structure
|
Common Name | 3,4-diphenylfuran-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54607-64-6 | Molecular Weight | 264.27500 | |
| Density | 1.227g/cm3 | Boiling Point | 396.2ºC at 760 mmHg | |
| Molecular Formula | C17H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | 3,4-diphenylfuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 396.2ºC at 760 mmHg |
| Molecular Formula | C17H12O3 |
| Molecular Weight | 264.27500 |
| Flash Point | 193.4ºC |
| Exact Mass | 264.07900 |
| PSA | 50.44000 |
| LogP | 4.31180 |
| Index of Refraction | 1.61 |
| InChIKey | KJVPADBZCZKNMP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1occ(-c2ccccc2)c1-c1ccccc1 |
| HS Code | 2932190090 |
|---|
|
~%
3,4-diphenylfur... CAS#:54607-64-6 |
| Literature: DAINIPPON PHARMACEUTICAL CO., LTD. Patent: EP1489077 A1, 2004 ; Location in patent: Page 34 ; |
|
~%
3,4-diphenylfur... CAS#:54607-64-6 |
| Literature: Hinsberg Chemische Berichte, 1912 , vol. 45, p. 2417 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,4-Diphenyl-furan-2-carbonsaeure |
| 3,4-diphenyl-2-furancarboxylic acid |
| 3,4-Diphenyl-2-furoic acid |
| 3,4-diphenyl-furan-2-carboxylic acid |