trimethyl-(2-nitryloxy-ethyl)-ammonium, nitric acid ester of choline structure
|
Common Name | trimethyl-(2-nitryloxy-ethyl)-ammonium, nitric acid ester of choline | ||
|---|---|---|---|---|
| CAS Number | 543-17-9 | Molecular Weight | 166.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-(2-nitryloxy-ethyl)-ammonium, nitric acid ester of choline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H14N2O4 |
|---|---|
| Molecular Weight | 166.17600 |
| Exact Mass | 166.09500 |
| PSA | 78.11000 |
| LogP | 0.24730 |
| InChIKey | ZQCMIIFDTOZOCG-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCO[N+](=O)[O-].[OH-] |
| Trimethyl-(2-nitrooxy-ethyl)-ammonium |
| hydroxide |
| Trimethyl-(2-nitryloxy-aethyl)-ammonium, Salpetersaeureester des Cholins |