1,3-Propanediol, 2-amino-2-methyl, salt with 1 f. wt. neoabietic acid
Modify Date: 2025-12-02 11:12:05
1,3-Propanediol, 2-amino-2-methyl, salt with 1 f. wt. neoabietic acid structure
|
Common Name | 1,3-Propanediol, 2-amino-2-methyl, salt with 1 f. wt. neoabietic acid | ||
|---|---|---|---|---|
| CAS Number | 5401-89-8 | Molecular Weight | 407.58700 | |
| Density | N/A | Boiling Point | 433.4ºC at 760 mmHg | |
| Molecular Formula | C24H41NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | 1,3-Propanediol, 2-amino-2-methyl, salt with 1 f. wt. neoabietic acid |
|---|
| Boiling Point | 433.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.58700 |
| Flash Point | 206ºC |
| Exact Mass | 407.30400 |
| PSA | 103.78000 |
| LogP | 4.73900 |
| InChIKey | BETBCNVDXAOPIB-UHFFFAOYSA-N |
| SMILES | CC(C)=C1C=C2CCC3C(C)(C(=O)O)CCCC3(C)C2CC1.CC(N)(CO)CO |