2-(4-propan-2-ylsulfanylphenyl)quinoxaline
Modify Date: 2025-10-03 19:42:24
2-(4-propan-2-ylsulfanylphenyl)quinoxaline structure
|
Common Name | 2-(4-propan-2-ylsulfanylphenyl)quinoxaline | ||
|---|---|---|---|---|
| CAS Number | 53609-06-6 | Molecular Weight | 280.38700 | |
| Density | 1.2g/cm3 | Boiling Point | 435.7ºC at 760 mmHg | |
| Molecular Formula | C17H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 2-(4-propan-2-ylsulfanylphenyl)quinoxaline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760 mmHg |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.38700 |
| Flash Point | 217.3ºC |
| Exact Mass | 280.10300 |
| PSA | 51.08000 |
| LogP | 4.79730 |
| Index of Refraction | 1.664 |
| InChIKey | WDMFPQDYDWSPND-UHFFFAOYSA-N |
| SMILES | CC(C)Sc1ccc(-c2cnc3ccccc3n2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoxaline,2-(4-((1-methylethyl)thio)phenyl) |
| 2-(4-isopropylsulfanyl-phenyl)-quinoxaline |
| 2-<4'-i-Propylthio>-phenyl-chinoxalin |
| 2-(4-Isopropylthiophenyl)quinoxaline |
| 2-(4-((1-Methylethyl)thio)phenyl)quinoxaline |