diethoxy-(6-prop-2-ynoxypyridazin-3-yl)oxy-sulfanylidene-λ5-phosphane structure
|
Common Name | diethoxy-(6-prop-2-ynoxypyridazin-3-yl)oxy-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 53605-05-3 | Molecular Weight | 302.28700 | |
| Density | 1.286g/cm3 | Boiling Point | 428.9ºC at 760 mmHg | |
| Molecular Formula | C11H15N2O4PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2ºC | |
| Name | diethoxy-(6-prop-2-ynoxypyridazin-3-yl)oxy-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760 mmHg |
| Molecular Formula | C11H15N2O4PS |
| Molecular Weight | 302.28700 |
| Flash Point | 213.2ºC |
| Exact Mass | 302.04900 |
| PSA | 104.60000 |
| LogP | 2.81550 |
| Index of Refraction | 1.546 |
| InChIKey | BUKJTCLDASSHGD-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc(OP(=S)(OCC)OCC)nn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| O,O-Diethyl O-(6-(2-propynyloxy)-3-pyridazinyl) phosphorothioate |
| Phosphorothioic acid,O,O-diethyl O-(6-(2-propynyloxy)-3-pyridazinyl) ester |
| diethoxy-(6-prop-2-ynoxypyridazin-3-yl)oxy-sulfanylidene |