methyl 3-chloro-4-[2-(2-chloro-4-methoxycarbonylphenoxy)ethoxy]benzoate
Modify Date: 2025-09-18 21:21:30
![methyl 3-chloro-4-[2-(2-chloro-4-methoxycarbonylphenoxy)ethoxy]benzoate Structure](https://image.chemsrc.com/caspic/103/53384-42-2.png)
methyl 3-chloro-4-[2-(2-chloro-4-methoxycarbonylphenoxy)ethoxy]benzoate structure
|
Common Name | methyl 3-chloro-4-[2-(2-chloro-4-methoxycarbonylphenoxy)ethoxy]benzoate | ||
|---|---|---|---|---|
| CAS Number | 53384-42-2 | Molecular Weight | 399.22200 | |
| Density | 1.339g/cm3 | Boiling Point | 525.2ºC at 760mmHg | |
| Molecular Formula | C18H16Cl2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | methyl 3-chloro-4-[2-(2-chloro-4-methoxycarbonylphenoxy)ethoxy]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 525.2ºC at 760mmHg |
| Molecular Formula | C18H16Cl2O6 |
| Molecular Weight | 399.22200 |
| Flash Point | 194.5ºC |
| Exact Mass | 398.03200 |
| PSA | 71.06000 |
| LogP | 4.02440 |
| Index of Refraction | 1.565 |
| InChIKey | MMRCXPIWRDKMHH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCCOc2ccc(C(=O)OC)cc2Cl)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 258-509-0 |
| Dimethyl 4,4'-(1,2-ethanediylbis(oxy))bis(3-chlorobenzoate) |
| dimethyl 1,2-bis(2-chlorophenoxy)ethane-4,4'-dicarboxylate |