N-[1-[9-(3-methylbutyl)carbazol-3-yl]ethyl]formamide
Modify Date: 2025-10-05 08:59:09
![N-[1-[9-(3-methylbutyl)carbazol-3-yl]ethyl]formamide Structure](https://image.chemsrc.com/caspic/003/52916-28-6.png)
N-[1-[9-(3-methylbutyl)carbazol-3-yl]ethyl]formamide structure
|
Common Name | N-[1-[9-(3-methylbutyl)carbazol-3-yl]ethyl]formamide | ||
|---|---|---|---|---|
| CAS Number | 52916-28-6 | Molecular Weight | 308.41700 | |
| Density | 1.1g/cm3 | Boiling Point | 478.2ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243ºC | |
| Name | N-[1-[9-(3-methylbutyl)carbazol-3-yl]ethyl]formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 478.2ºC at 760 mmHg |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.41700 |
| Flash Point | 243ºC |
| Exact Mass | 308.18900 |
| PSA | 37.52000 |
| LogP | 5.48790 |
| Index of Refraction | 1.591 |
| InChIKey | NUYSVIQWASSMGG-UHFFFAOYSA-N |
| SMILES | CC(C)CCn1c2ccccc2c2cc(C(C)NC=O)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Formamide,N-(1-(9-(3-methylbutyl)-9H-carbazol-3-yl)ethyl) |
| N-{1-[9-(3-methyl-butyl)-carbazol-3-yl]-ethyl}-formamide |
| N-(1-(9-(3-Methylbutyl)-9H-carbazol-3-yl)ethyl)formamide |