2-methyl-2,3,6,7,8,9-hexahydro-benzo[4,5]thieno[2,3-d]thiazolo[3,2-a]pyrimidin-5-one
Modify Date: 2025-08-24 18:54:03
![2-methyl-2,3,6,7,8,9-hexahydro-benzo[4,5]thieno[2,3-d]thiazolo[3,2-a]pyrimidin-5-one Structure](https://image.chemsrc.com/caspic/451/52881-31-9.png)
2-methyl-2,3,6,7,8,9-hexahydro-benzo[4,5]thieno[2,3-d]thiazolo[3,2-a]pyrimidin-5-one structure
|
Common Name | 2-methyl-2,3,6,7,8,9-hexahydro-benzo[4,5]thieno[2,3-d]thiazolo[3,2-a]pyrimidin-5-one | ||
|---|---|---|---|---|
| CAS Number | 52881-31-9 | Molecular Weight | 278.39300 | |
| Density | 1.64g/cm3 | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C13H14N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | 2-methyl-2,3,6,7,8,9-hexahydro-benzo[4,5]thieno[2,3-d]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 495.9ºC at 760 mmHg |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.39300 |
| Flash Point | 253.7ºC |
| Exact Mass | 278.05500 |
| PSA | 88.43000 |
| LogP | 2.83100 |
| Index of Refraction | 1.852 |
| InChIKey | AGHVRPBAUBGGEI-UHFFFAOYSA-N |
| SMILES | CC1Cn2c(nc3sc4c(c3c2=O)CCCC4)S1 |
|
~%
2-methyl-2,3,6,... CAS#:52881-31-9 |
| Literature: Devani; Shishoo; Pathak; Parikh; Shah; Padhya Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 5 p. 660 - 664 |
|
~%
2-methyl-2,3,6,... CAS#:52881-31-9 |
| Literature: Sauter,F. et al. Monatshefte fuer Chemie, 1974 , vol. 105, p. 863 - 868 |
![3-prop-2-enyl-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one structure](https://image.chemsrc.com/caspic/199/42062-91-9.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4,6,7,8,9-pentahydro-2H,3H-benzo[b]thiopheno[2,3-d]1,3-thiazolidino[3,2-a]pyrimidin-5-one |