2,4,6-tris(2,3-dibromopropoxy)-1,3,5-triazine structure
|
Common Name | 2,4,6-tris(2,3-dibromopropoxy)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 52434-59-0 | Molecular Weight | 728.69000 | |
| Density | 2.275g/cm3 | Boiling Point | 634.391ºC at 760 mmHg | |
| Molecular Formula | C12H15Br6N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 337.467ºC | |
| Name | 2,4,6-tris(2,3-dibromopropoxy)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.275g/cm3 |
|---|---|
| Boiling Point | 634.391ºC at 760 mmHg |
| Molecular Formula | C12H15Br6N3O3 |
| Molecular Weight | 728.69000 |
| Flash Point | 337.467ºC |
| Exact Mass | 722.62100 |
| PSA | 66.36000 |
| LogP | 4.48320 |
| Index of Refraction | 1.634 |
| InChIKey | DUPDOFDRVXJYOF-UHFFFAOYSA-N |
| SMILES | BrCC(Br)COc1nc(OCC(Br)CBr)nc(OCC(Br)CBr)n1 |
| HS Code | 2933699090 |
|---|
|
~%
2,4,6-tris(2,3-... CAS#:52434-59-0 |
| Literature: DEGUSSA AG Patent: EP1634875 A1, 2006 ; Location in patent: Page/Page column 4 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3,5-Triazine,2,4,6-tris(2,3-dibromopropoxy) |