4-(3-nitrophenyl)selenadiazole
Modify Date: 2025-08-25 19:35:33
4-(3-nitrophenyl)selenadiazole structure
|
Common Name | 4-(3-nitrophenyl)selenadiazole | ||
|---|---|---|---|---|
| CAS Number | 52376-72-4 | Molecular Weight | 254.10400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-nitrophenyl)selenadiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H5N3O2Se |
|---|---|
| Molecular Weight | 254.10400 |
| Exact Mass | 254.95500 |
| PSA | 71.60000 |
| LogP | 1.63200 |
| InChIKey | MZDVPDODRXSFFE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2c[se]nn2)c1 |
|
~%
4-(3-nitropheny... CAS#:52376-72-4 |
| Literature: Caplin,A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1974 , p. 30 - 31 |
![Hydrazinecarboxamide,2-[1-(3-nitrophenyl)ethylidene]- structure](https://image.chemsrc.com/caspic/156/22107-29-5.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,3-Selenadiazole,4-(3-nitrophenyl) |