2-benzofuran-1,3-dione,furan-2,5-dione,3-(3-hydroxypropoxy)propan-1-ol
Modify Date: 2025-10-27 10:06:27
2-benzofuran-1,3-dione,furan-2,5-dione,3-(3-hydroxypropoxy)propan-1-ol structure
|
Common Name | 2-benzofuran-1,3-dione,furan-2,5-dione,3-(3-hydroxypropoxy)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 51922-42-0 | Molecular Weight | 380.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzofuran-1,3-dione,furan-2,5-dione,3-(3-hydroxypropoxy)propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20O9 |
|---|---|
| Molecular Weight | 380.34600 |
| Exact Mass | 380.11100 |
| PSA | 136.43000 |
| LogP | 0.39100 |
| InChIKey | WXEYFOLJQAJASD-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)O1.O=C1OC(=O)c2ccccc21.OCCCOCCCO |
| Oxybispropanol,2,5-furandione,1,3-isobenzofurandione polymer |
| 1,3-Isobenzofurandione,polymer with 2,5-furandione and oxybis(propanol) |