N-(4-chloro-2-methylphenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine
Modify Date: 2025-08-26 09:44:34
N-(4-chloro-2-methylphenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine structure
|
Common Name | N-(4-chloro-2-methylphenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine | ||
|---|---|---|---|---|
| CAS Number | 51170-86-6 | Molecular Weight | 290.83100 | |
| Density | 1.07g/cm3 | Boiling Point | 408.5ºC at 760 mmHg | |
| Molecular Formula | C17H23ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | N-(4-chloro-2-methylphenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine |
|---|
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 408.5ºC at 760 mmHg |
| Molecular Formula | C17H23ClN2 |
| Molecular Weight | 290.83100 |
| Flash Point | 200.9ºC |
| Exact Mass | 290.15500 |
| PSA | 15.60000 |
| LogP | 5.41600 |
| Index of Refraction | 1.552 |
| InChIKey | TYILANVJSHDFHJ-UHFFFAOYSA-N |
| SMILES | CCC(=CN1CCCC1=Nc1ccc(Cl)cc1C)CC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |