2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole
Modify Date: 2026-08-21 10:46:40
2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole structure
|
Common Name | 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole | ||
|---|---|---|---|---|
| CAS Number | 50737-33-2 | Molecular Weight | 263.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5Cl3N2O |
|---|---|
| Molecular Weight | 263.5 |
| InChIKey | WMEIIKCHOFVOKB-UHFFFAOYSA-N |
| SMILES | ClCc1nnc(-c2cc(Cl)ccc2Cl)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: Molecular formula of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is C9H5Cl3N2O. |
| Q: What is the CAS number of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: CAS number of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is 50737-33-2. |
| Q: What is the SMILES notation of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: SMILES notation of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is ClCc1nnc(-c2cc(Cl)ccc2Cl)o1. |
| Q: What is the Chinese name of 50737-33-2? |
| A: Chinese name of 50737-33-2 is 50737-33-2. |
| Q: What is the molecular weight of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: Molecular weight of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is 263.5. |
| Q: What is the English name of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: The English name of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole. |
| Q: What is the InChIKey of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole? |
| A: InChIKey of 2-(Chloromethyl)-5-(2,5-dichlorophenyl)-1,3,4-oxadiazole is WMEIIKCHOFVOKB-UHFFFAOYSA-N. |