6-ethoxy-1-[3-methoxy-4-(2-methylpropoxy)phenyl]-1,2,3,4-tetrahydroisoquinoline structure
|
Common Name | 6-ethoxy-1-[3-methoxy-4-(2-methylpropoxy)phenyl]-1,2,3,4-tetrahydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 5065-37-2 | Molecular Weight | 355.47100 | |
| Density | 1.061g/cm3 | Boiling Point | 479.9ºC at 760 mmHg | |
| Molecular Formula | C22H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 6-ethoxy-1-[3-methoxy-4-(2-methylpropoxy)phenyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 479.9ºC at 760 mmHg |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.47100 |
| Flash Point | 208.6ºC |
| Exact Mass | 355.21500 |
| PSA | 39.72000 |
| LogP | 4.69260 |
| Index of Refraction | 1.537 |
| InChIKey | GKPGKUZYCPWWEI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2c(c1)CCNC2c1ccc(OCC(C)C)c(OC)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-3-formyl-5-methoxy-2-methyl-1,6-diethyl-indol |
| 4-amino-1,6-diethyl-5-methoxy-2-methyl-indole-3-carbaldehyde |