2-(propan-2-yloxycarbonylamino)butyl N-phenylcarbamate
Modify Date: 2025-09-12 23:25:59
2-(propan-2-yloxycarbonylamino)butyl N-phenylcarbamate structure
|
Common Name | 2-(propan-2-yloxycarbonylamino)butyl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 5049-43-4 | Molecular Weight | 294.34600 | |
| Density | 1.143g/cm3 | Boiling Point | 397.5ºC at 760 mmHg | |
| Molecular Formula | C15H22N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 2-(propan-2-yloxycarbonylamino)butyl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 397.5ºC at 760 mmHg |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.34600 |
| Flash Point | 194.2ºC |
| Exact Mass | 294.15800 |
| PSA | 83.64000 |
| LogP | 3.36630 |
| Index of Refraction | 1.533 |
| InChIKey | PQZJNXCALMSVSM-UHFFFAOYSA-N |
| SMILES | CCC(COC(=O)Nc1ccccc1)NC(=O)OC(C)C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2658O08 |
| Phenyl-carbamic acid 2-isopropoxycarbonylamino-butyl ester |