1-(3,4-dimethoxyphenyl)-2-(2-methoxy-4-propylphenoxy)propan-1-one structure
|
Common Name | 1-(3,4-dimethoxyphenyl)-2-(2-methoxy-4-propylphenoxy)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 50393-95-8 | Molecular Weight | 358.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-dimethoxyphenyl)-2-(2-methoxy-4-propylphenoxy)propan-1-one |
|---|
| Molecular Formula | C21H26O5 |
|---|---|
| Molecular Weight | 358.42800 |
| Exact Mass | 358.17800 |
| PSA | 53.99000 |
| LogP | 4.31510 |
| InChIKey | NZSSCWAYKSQUBU-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(OC(C)C(=O)c2ccc(OC)c(OC)c2)c(OC)c1 |
|
~%
1-(3,4-dimethox... CAS#:50393-95-8 |
| Literature: Sarkanen,K.V.; Wallis,A.F.A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1869 - 1878 |
|
~%
1-(3,4-dimethox... CAS#:50393-95-8 |
| Literature: Sarkanen,K.V.; Wallis,A.F.A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1869 - 1878 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |