N-[2-(diethylamino)acetyl]-2-(2-phenylpropan-2-ylamino)acetamide
Modify Date: 2025-09-14 14:06:08
![N-[2-(diethylamino)acetyl]-2-(2-phenylpropan-2-ylamino)acetamide Structure](https://image.chemsrc.com/caspic/152/50333-32-9.png)
N-[2-(diethylamino)acetyl]-2-(2-phenylpropan-2-ylamino)acetamide structure
|
Common Name | N-[2-(diethylamino)acetyl]-2-(2-phenylpropan-2-ylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 50333-32-9 | Molecular Weight | 305.41500 | |
| Density | 1.05g/cm3 | Boiling Point | 433.2ºC at 760 mmHg | |
| Molecular Formula | C17H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | N-[2-(diethylamino)acetyl]-2-(2-phenylpropan-2-ylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760 mmHg |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.41500 |
| Flash Point | 215.8ºC |
| Exact Mass | 305.21000 |
| PSA | 64.93000 |
| LogP | 2.72710 |
| Index of Refraction | 1.517 |
| InChIKey | GZYJKGUBIAWBFI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC(=O)CNC(C)(C)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| gea 980 |