N,N,2-trimethyl-4-[(3-nitrophenyl)diazenyl]aniline structure
|
Common Name | N,N,2-trimethyl-4-[(3-nitrophenyl)diazenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 4313-14-8 | Molecular Weight | 284.31300 | |
| Density | 1.18g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C15H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | N,N,2-trimethyl-4-[(3-nitrophenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.31300 |
| Flash Point | 231.4ºC |
| Exact Mass | 284.12700 |
| PSA | 73.78000 |
| LogP | 4.90780 |
| Index of Refraction | 1.596 |
| InChIKey | XTRHCXVROUJEFC-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=Nc2cccc([N+](=O)[O-])c2)ccc1N(C)C |
| HS Code | 2927000090 |
|---|
|
~%
N,N,2-trimethyl... CAS#:4313-14-8 |
| Literature: Sawicki; Gerber Journal of Organic Chemistry, 1956 , vol. 21, p. 410 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Dimethylamino-3-methyl-3'-nitro-azobenzol |
| 3'-Nitro-3-methyl-4-dimethylamino-azobenzol |