N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide
Modify Date: 2026-06-27 10:43:44
N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide structure
|
Common Name | N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 425410-68-0 | Molecular Weight | 391.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H17NO4S |
|---|---|
| Molecular Weight | 391.4 |
| InChIKey | PEIRUDDLVWFUTA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NS(=O)(=O)C2=CC=CC3=C2C(=O)C4=CC=CC=C4C3=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: SMILES notation of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is CC1=CC(=C(C=C1)C)NS(=O)(=O)C2=CC=CC3=C2C(=O)C4=CC=CC=C4C3=O. |
| Q: What is the English name of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: The English name of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide. |
| Q: What is the Chinese name of 425410-68-0? |
| A: Chinese name of 425410-68-0 is 425410-68-0. |
| Q: What is the molecular formula of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: Molecular formula of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is C22H17NO4S. |
| Q: What is the CAS number of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: CAS number of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is 425410-68-0. |
| Q: What is the molecular weight of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: Molecular weight of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is 391.4. |
| Q: What is the InChIKey of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide? |
| A: InChIKey of N-(2,5-dimethylphenyl)-9,10-dioxo-9,10-dihydro-1-anthracenesulfonamide is PEIRUDDLVWFUTA-UHFFFAOYSA-N. |