2-hydroxy-N-[1-hydroxy-2-oxo-2-(4-phenylphenyl)ethyl]benzamide
Modify Date: 2025-12-01 20:54:39
![2-hydroxy-N-[1-hydroxy-2-oxo-2-(4-phenylphenyl)ethyl]benzamide Structure](https://image.chemsrc.com/caspic/319/42177-46-8.png)
2-hydroxy-N-[1-hydroxy-2-oxo-2-(4-phenylphenyl)ethyl]benzamide structure
|
Common Name | 2-hydroxy-N-[1-hydroxy-2-oxo-2-(4-phenylphenyl)ethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 42177-46-8 | Molecular Weight | 347.36400 | |
| Density | 1.299g/cm3 | Boiling Point | 620.7ºC at 760mmHg | |
| Molecular Formula | C21H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.2ºC | |
| Name | 2-hydroxy-N-[1-hydroxy-2-oxo-2-(4-phenylphenyl)ethyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 620.7ºC at 760mmHg |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.36400 |
| Flash Point | 329.2ºC |
| Exact Mass | 347.11600 |
| PSA | 90.12000 |
| LogP | 3.56510 |
| Index of Refraction | 1.649 |
| InChIKey | UDRWNTMPNLKXNO-UHFFFAOYSA-N |
| SMILES | O=C(NC(O)C(=O)c1ccc(-c2ccccc2)cc1)c1ccccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Biphenylylglyoxal salicylamido-hemiacetal |