2-hydroxyimino-3-oxo-butyric acid o-anisidide
Modify Date: 2025-09-19 12:56:46
2-hydroxyimino-3-oxo-butyric acid o-anisidide structure
|
Common Name | 2-hydroxyimino-3-oxo-butyric acid o-anisidide | ||
|---|---|---|---|---|
| CAS Number | 42056-95-1 | Molecular Weight | 236.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxyimino-3-oxo-butyric acid o-anisidide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O4 |
|---|---|
| Molecular Weight | 236.22400 |
| Exact Mass | 236.08000 |
| PSA | 87.99000 |
| LogP | 1.12590 |
| InChIKey | YTEQNNGQRXIVGT-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)C(N=O)=C(C)O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(hydroxyimino)-n-(2-methoxyphenyl)-3-oxobutanamide |
| 2-hydroxyimino-n-(2-methoxy-phenyl)-3-oxo-butyramide |