6-(dimethylamino)-4-(4-hydroxyphenyl)-4-phenylheptan-3-one
Modify Date: 2025-09-30 22:10:42
6-(dimethylamino)-4-(4-hydroxyphenyl)-4-phenylheptan-3-one structure
|
Common Name | 6-(dimethylamino)-4-(4-hydroxyphenyl)-4-phenylheptan-3-one | ||
|---|---|---|---|---|
| CAS Number | 41238-35-1 | Molecular Weight | 325.44500 | |
| Density | 1.067g/cm3 | Boiling Point | 471.3ºC at 760 mmHg | |
| Molecular Formula | C21H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 6-(dimethylamino)-4-(4-hydroxyphenyl)-4-phenylheptan-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.067g/cm3 |
|---|---|
| Boiling Point | 471.3ºC at 760 mmHg |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.44500 |
| Flash Point | 238.9ºC |
| Exact Mass | 325.20400 |
| PSA | 40.54000 |
| LogP | 3.99760 |
| Index of Refraction | 1.554 |
| InChIKey | MNOLUSMZZLSOKM-UHFFFAOYSA-N |
| SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccc(O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Heptanone,6-(dimethylamino)-4-(4-hydroxyphenyl)-4-phenyl |
| p-Hydroxymethadone |
| 6-Dimethylamino-4-(4-hydroxyphenyl)-4-phenylheptan-3-one |
| para-Hydroxymethadone |